C15H16Cl2O2S — CID 13379923
(3aR,7aR)-3,3-dichloro-7a-(4-methylphenyl)sulfanyl-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one (PubChem CID 13379923) has the molecular formula C15H16Cl2O2S and a molecular weight of 331.26 g/mol. Its IUPAC name is (3aR,7aR)-3,3-dichloro-7a-(4-methylphenyl)sulfanyl-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one.
| Compound Name | (3aR,7aR)-3,3-dichloro-7a-(4-methylphenyl)sulfanyl-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one |
|---|---|
| PubChem CID | 13379923 |
| Molecular Formula | C15H16Cl2O2S |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | (3aR,7aR)-3,3-dichloro-7a-(4-methylphenyl)sulfanyl-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one |
| SMILES | Cc1ccc(S[C@]23CCCC[C@H]2C(Cl)(Cl)C(=O)O3)cc1 |
| InChI | InChI=1S/C15H16Cl2O2S/c1-10-5-7-11(8-6-10)20-14-9-3-2-4-12(14)15(16,17)13(18)19-14/h5-8,12H,2-4,9H2,1H3/t12-,14-/m1/s1 |
| InChIKey | GMNUDZOKETZKOY-TZMCWYRMSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|