C14H16Cl2O2S — CID 11726922
(4R,5R)-3,3-dichloro-5-ethyl-4-methyl-5-(4-methylphenyl)sulfanyloxolan-2-one (PubChem CID 11726922) has the molecular formula C14H16Cl2O2S and a molecular weight of 319.25 g/mol. Its IUPAC name is (4R,5R)-3,3-dichloro-5-ethyl-4-methyl-5-(4-methylphenyl)sulfanyloxolan-2-one.
| Compound Name | (4R,5R)-3,3-dichloro-5-ethyl-4-methyl-5-(4-methylphenyl)sulfanyloxolan-2-one |
|---|---|
| PubChem CID | 11726922 |
| Molecular Formula | C14H16Cl2O2S |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (4R,5R)-3,3-dichloro-5-ethyl-4-methyl-5-(4-methylphenyl)sulfanyloxolan-2-one |
| SMILES | CC[C@]1(Sc2ccc(C)cc2)OC(=O)C(Cl)(Cl)[C@@H]1C |
| InChI | InChI=1S/C14H16Cl2O2S/c1-4-13(10(3)14(15,16)12(17)18-13)19-11-7-5-9(2)6-8-11/h5-8,10H,4H2,1-3H3/t10-,13-/m1/s1 |
| InChIKey | GEKYPRJGBZIBEM-ZWNOBZJWSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|