C14H16Cl2O2S — CID 153284451
(4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one (PubChem CID 153284451) has the molecular formula C14H16Cl2O2S and a molecular weight of 319.25 g/mol. Its IUPAC name is (4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one.
| Compound Name | (4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one |
|---|---|
| PubChem CID | 153284451 |
| Molecular Formula | C14H16Cl2O2S |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one |
| SMILES | CCC[C@H]1[C@@H](Sc2ccc(C)cc2)OC(=O)C1(Cl)Cl |
| InChI | InChI=1S/C14H16Cl2O2S/c1-3-4-11-12(18-13(17)14(11,15)16)19-10-7-5-9(2)6-8-10/h5-8,11-12H,3-4H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | RXROAARSJRSEQM-NWDGAFQWSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|