C14H18O2S — CID 14377509
(4R,5R)-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one (PubChem CID 14377509) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (4R,5R)-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one.
| Compound Name | (4R,5R)-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one |
|---|---|
| PubChem CID | 14377509 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (4R,5R)-5-(4-methylphenyl)sulfanyl-4-propyloxolan-2-one |
| SMILES | CCC[C@@H]1CC(=O)O[C@@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O2S/c1-3-4-11-9-13(15)16-14(11)17-12-7-5-10(2)6-8-12/h5-8,11,14H,3-4,9H2,1-2H3/t11-,14-/m1/s1 |
| InChIKey | ZNNRVYUUKUFNQS-BXUZGUMPSA-N |
| XLogP | 3.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |