C15H21N5O4 — CID 13382920
ethyl (3E)-3-[(6-morpholin-4-ylpyridazine-3-carbonyl)hydrazinylidene]butanoate (PubChem CID 13382920) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl (3E)-3-[(6-morpholin-4-ylpyridazine-3-carbonyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (3E)-3-[(6-morpholin-4-ylpyridazine-3-carbonyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 13382920 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | ethyl (3E)-3-[(6-morpholin-4-ylpyridazine-3-carbonyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C/C(C)=N/NC(=O)c1ccc(N2CCOCC2)nn1 |
| InChI | InChI=1S/C15H21N5O4/c1-3-24-14(21)10-11(2)16-19-15(22)12-4-5-13(18-17-12)20-6-8-23-9-7-20/h4-5H,3,6-10H2,1-2H3,(H,19,22)/b16-11+ |
| InChIKey | JDJOEAODUYRTPS-LFIBNONCSA-N |
| XLogP | 0.37 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|