C24H40N2O4 — CID 13388433
1-(butylamino)-3-[[4-[3-(butylamino)-2-hydroxypropoxy]-5,8-dihydronaphthalen-1-yl]oxy]propan-2-ol (PubChem CID 13388433) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is 1-(butylamino)-3-[[4-[3-(butylamino)-2-hydroxypropoxy]-5,8-dihydronaphthalen-1-yl]oxy]propan-2-ol.
| Compound Name | 1-(butylamino)-3-[[4-[3-(butylamino)-2-hydroxypropoxy]-5,8-dihydronaphthalen-1-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 13388433 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 1-(butylamino)-3-[[4-[3-(butylamino)-2-hydroxypropoxy]-5,8-dihydronaphthalen-1-yl]oxy]propan-2-ol |
| SMILES | CCCCNCC(O)COc1ccc(OCC(O)CNCCCC)c2c1CC=CC2 |
| InChI | InChI=1S/C24H40N2O4/c1-3-5-13-25-15-19(27)17-29-23-11-12-24(22-10-8-7-9-21(22)23)30-18-20(28)16-26-14-6-4-2/h7-8,11-12,19-20,25-28H,3-6,9-10,13-18H2,1-2H3 |
| InChIKey | ALTRNLKUKUGJJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|