C12H16O5 — CID 13391498
ethyl 4-(1-hydroxypropylidene)-3,5-dioxocyclohexane-1-carboxylate (PubChem CID 13391498) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl 4-(1-hydroxypropylidene)-3,5-dioxocyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(1-hydroxypropylidene)-3,5-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 13391498 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl 4-(1-hydroxypropylidene)-3,5-dioxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)C(=C(O)CC)C(=O)C1 |
| InChI | InChI=1S/C12H16O5/c1-3-8(13)11-9(14)5-7(6-10(11)15)12(16)17-4-2/h7,13H,3-6H2,1-2H3/b11-8- |
| InChIKey | NULCWFWEJLOMLG-FLIBITNWSA-N |
| XLogP | 1.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|