C19H22N2O2 — CID 13392589
(E)-N,N-diethyl-2-methyl-3-(4-pyridin-3-yloxyphenyl)prop-2-enamide (PubChem CID 13392589) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (E)-N,N-diethyl-2-methyl-3-(4-pyridin-3-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N,N-diethyl-2-methyl-3-(4-pyridin-3-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 13392589 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (E)-N,N-diethyl-2-methyl-3-(4-pyridin-3-yloxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(C)=C/c1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-4-21(5-2)19(22)15(3)13-16-8-10-17(11-9-16)23-18-7-6-12-20-14-18/h6-14H,4-5H2,1-3H3/b15-13+ |
| InChIKey | HMWLTIRJQPCOOH-FYWRMAATSA-N |
| XLogP | 4.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|