C26H24N4O4 — CID 69130272
2-[4-[4-[3-(carbamoylamino)-3-oxoprop-1-enyl]phenoxy]phenyl]-N,N-dimethyl-3-pyridin-3-ylprop-2-enamide (PubChem CID 69130272) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[4-[4-[3-(carbamoylamino)-3-oxoprop-1-enyl]phenoxy]phenyl]-N,N-dimethyl-3-pyridin-3-ylprop-2-enamide.
| Compound Name | 2-[4-[4-[3-(carbamoylamino)-3-oxoprop-1-enyl]phenoxy]phenyl]-N,N-dimethyl-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 69130272 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[4-[4-[3-(carbamoylamino)-3-oxoprop-1-enyl]phenoxy]phenyl]-N,N-dimethyl-3-pyridin-3-ylprop-2-enamide |
| SMILES | CN(C)C(=O)C(=Cc1cccnc1)c1ccc(Oc2ccc(C=CC(=O)NC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C26H24N4O4/c1-30(2)25(32)23(16-19-4-3-15-28-17-19)20-8-12-22(13-9-20)34-21-10-5-18(6-11-21)7-14-24(31)29-26(27)33/h3-17H,1-2H3,(H3,27,29,31,33) |
| InChIKey | LJEDINLIDYSUIO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|