C14H10BrF3N2OS — CID 134003648
2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 134003648) has the molecular formula C14H10BrF3N2OS and a molecular weight of 391.21 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 134003648 |
| Molecular Formula | C14H10BrF3N2OS |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1ccc(Br)cn1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H10BrF3N2OS/c15-9-5-6-13(19-7-9)22-8-12(21)20-11-4-2-1-3-10(11)14(16,17)18/h1-7H,8H2,(H,20,21) |
| InChIKey | YKKKBCRVSLSBKW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |