C12H16F3N3O2S — CID 134005272
1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 134005272) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 134005272 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C12H16F3N3O2S/c13-12(14,15)9-20-7-1-10(19)17-3-5-18(6-4-17)11-16-2-8-21-11/h2,8H,1,3-7,9H2 |
| InChIKey | BHYUUPXADJNHKF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|