About (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate
(3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 13400955) has the molecular formula C10H11BrO3
and a molecular weight of 259.10 g/mol. Its IUPAC name is (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
Analyze (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The IUPAC name of (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (CID 13400955) is (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
What is the SMILES notation for (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The canonical SMILES for (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is CC(=O)OC1(C)C=C(Br)C=C(C)C1=O.
What is the InChIKey of (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The InChIKey is PRLYBVZLCKNVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO3/c1-6-4-8(11)5-10(3,9(6)13)14-7(2)12/h4-5H,1-3H3.
What are the key properties of (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
(3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate has a molecular weight of 259.10 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-1,5-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is sourced from PubChem (CID 13400955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).