C26H29ClN4O4 — CID 134011139
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide (PubChem CID 134011139) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 134011139 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)CCc1ncc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C26H29ClN4O4/c1-2-30(18-24(32)29-19-7-9-20(10-8-19)31-13-15-34-16-14-31)26(33)12-11-25-28-17-23(35-25)21-5-3-4-6-22(21)27/h3-10,17H,2,11-16,18H2,1H3,(H,29,32) |
| InChIKey | HFLAZZKUZVHTHN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|