C15H12INO4 — CID 134016693
(E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-iodofuran-2-yl)prop-2-enamide (PubChem CID 134016693) has the molecular formula C15H12INO4 and a molecular weight of 397.17 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-iodofuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-iodofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134016693 |
| Molecular Formula | C15H12INO4 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-iodofuran-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(I)o1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12INO4/c16-14-5-2-11(21-14)3-6-15(18)17-8-10-1-4-12-13(7-10)20-9-19-12/h1-7H,8-9H2,(H,17,18)/b6-3+ |
| InChIKey | WYXKWPCKJIHQKW-ZZXKWVIFSA-N |
| XLogP | 2.94 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|