C9H16FN3O3 — CID 13401961
1-(2-fluoroethyl)-3-[(1R,2S)-2-hydroxycyclohexyl]-1-nitrosourea (PubChem CID 13401961) has the molecular formula C9H16FN3O3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-[(1R,2S)-2-hydroxycyclohexyl]-1-nitrosourea.
| Compound Name | 1-(2-fluoroethyl)-3-[(1R,2S)-2-hydroxycyclohexyl]-1-nitrosourea |
|---|---|
| PubChem CID | 13401961 |
| Molecular Formula | C9H16FN3O3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(2-fluoroethyl)-3-[(1R,2S)-2-hydroxycyclohexyl]-1-nitrosourea |
| SMILES | O=NN(CCF)C(=O)N[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C9H16FN3O3/c10-5-6-13(12-16)9(15)11-7-3-1-2-4-8(7)14/h7-8,14H,1-6H2,(H,11,15)/t7-,8+/m1/s1 |
| InChIKey | FRDWTIYUTIYIOD-SFYZADRCSA-N |
| XLogP | 0.95 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|