C17H22ClN3OS — CID 134021290
4-(4-chlorophenyl)sulfanyl-N-[2-(2-methylpropyl)pyrazol-3-yl]butanamide (PubChem CID 134021290) has the molecular formula C17H22ClN3OS and a molecular weight of 351.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[2-(2-methylpropyl)pyrazol-3-yl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[2-(2-methylpropyl)pyrazol-3-yl]butanamide |
|---|---|
| PubChem CID | 134021290 |
| Molecular Formula | C17H22ClN3OS |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[2-(2-methylpropyl)pyrazol-3-yl]butanamide |
| SMILES | CC(C)Cn1nccc1NC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClN3OS/c1-13(2)12-21-16(9-10-19-21)20-17(22)4-3-11-23-15-7-5-14(18)6-8-15/h5-10,13H,3-4,11-12H2,1-2H3,(H,20,22) |
| InChIKey | VFJKBKOQNNXWQX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|