C15H13ClF3N3O2S — CID 134026484
N-(5-chloro-2-methoxyphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide (PubChem CID 134026484) has the molecular formula C15H13ClF3N3O2S and a molecular weight of 391.80 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 134026484 |
| Molecular Formula | C15H13ClF3N3O2S |
| Molecular Weight | 391.80 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(C)Sc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H13ClF3N3O2S/c1-8(25-14-20-6-5-12(22-14)15(17,18)19)13(23)21-10-7-9(16)3-4-11(10)24-2/h3-8H,1-2H3,(H,21,23) |
| InChIKey | MPPZEPHUGFMUIU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |