C14H13F3N4O3S2 — CID 46519227
N-(4-sulfamoylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide (PubChem CID 46519227) has the molecular formula C14H13F3N4O3S2 and a molecular weight of 406.41 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46519227 |
| Molecular Formula | C14H13F3N4O3S2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nccc(C(F)(F)F)n1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H13F3N4O3S2/c1-8(25-13-19-7-6-11(21-13)14(15,16)17)12(22)20-9-2-4-10(5-3-9)26(18,23)24/h2-8H,1H3,(H,20,22)(H2,18,23,24) |
| InChIKey | NJKCIMHMMZFCBR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |