C17H15N5O3S — CID 134027715
1-ethyl-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 134027715) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 1-ethyl-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 134027715 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-ethyl-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NCc3cn4ccsc4n3)ccc21 |
| InChI | InChI=1S/C17H15N5O3S/c1-2-22-13-4-3-10(7-12(13)20-15(24)16(22)25)14(23)18-8-11-9-21-5-6-26-17(21)19-11/h3-7,9H,2,8H2,1H3,(H,18,23)(H,20,24) |
| InChIKey | RAUJMJBSDMAALY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|