C23H26N2O3S — CID 134031168
4-[2-[2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one (PubChem CID 134031168) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[2-[2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one.
| Compound Name | 4-[2-[2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 134031168 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[2-[2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(C2CCCCCN2C(=O)CN2C(=O)CSc3ccccc32)cc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-28-18-12-10-17(11-13-18)19-7-3-2-6-14-24(19)22(26)15-25-20-8-4-5-9-21(20)29-16-23(25)27/h4-5,8-13,19H,2-3,6-7,14-16H2,1H3 |
| InChIKey | MZISTZDLVRETHV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |