C15H16ClN3O3S — CID 134036405
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)prop-2-enamide (PubChem CID 134036405) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 134036405 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)prop-2-enamide |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)Nc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H16ClN3O3S/c1-10-13(15(16)19(2)18-10)8-9-14(20)17-11-4-6-12(7-5-11)23(3,21)22/h4-9H,1-3H3,(H,17,20)/b9-8+ |
| InChIKey | FIUAHOOWUUZVOR-CMDGGOBGSA-N |
| XLogP | 2.44 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|