C13H12ClN3O3S — CID 43357472
2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid (PubChem CID 43357472) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is 2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43357472 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C13H12ClN3O3S/c1-7-8(11(14)17(2)16-7)3-4-10(18)15-12-9(13(19)20)5-6-21-12/h3-6H,1-2H3,(H,15,18)(H,19,20)/b4-3+ |
| InChIKey | PRFYTDPSGIWMJN-ONEGZZNKSA-N |
| XLogP | 2.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|