C15H14Cl2N4O2 — CID 35930069
2-chloro-N'-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]benzohydrazide (PubChem CID 35930069) has the molecular formula C15H14Cl2N4O2 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-chloro-N'-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 35930069 |
| Molecular Formula | C15H14Cl2N4O2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-chloro-N'-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]benzohydrazide |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H14Cl2N4O2/c1-9-10(14(17)21(2)20-9)7-8-13(22)18-19-15(23)11-5-3-4-6-12(11)16/h3-8H,1-2H3,(H,18,22)(H,19,23)/b8-7+ |
| InChIKey | JNEJCNQROHIHME-BQYQJAHWSA-N |
| XLogP | 2.51 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|