C15H14ClF2N3O3S — CID 76857685
3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide (PubChem CID 76857685) has the molecular formula C15H14ClF2N3O3S and a molecular weight of 389.81 g/mol. Its IUPAC name is 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide.
| Compound Name | 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76857685 |
| Molecular Formula | C15H14ClF2N3O3S |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide |
| SMILES | Cc1nn(C)c(Cl)c1C=CC(=O)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C15H14ClF2N3O3S/c1-9-10(14(16)21(2)20-9)7-8-13(22)19-11-5-3-4-6-12(11)25(23,24)15(17)18/h3-8,15H,1-2H3,(H,19,22) |
| InChIKey | SIGZVIQXJWCHMG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|