C16H12BrF2NO3S — CID 76858905
3-(2-bromophenyl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide (PubChem CID 76858905) has the molecular formula C16H12BrF2NO3S and a molecular weight of 416.24 g/mol. Its IUPAC name is 3-(2-bromophenyl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide.
| Compound Name | 3-(2-bromophenyl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76858905 |
| Molecular Formula | C16H12BrF2NO3S |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 3-(2-bromophenyl)-N-[2-(difluoromethylsulfonyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Br)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C16H12BrF2NO3S/c17-12-6-2-1-5-11(12)9-10-15(21)20-13-7-3-4-8-14(13)24(22,23)16(18)19/h1-10,16H,(H,20,21) |
| InChIKey | MMBJPCJIKNHBGM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|