C20H21F2NO5S — CID 55340127
(E)-N-[2-(difluoromethylsulfonyl)phenyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide (PubChem CID 55340127) has the molecular formula C20H21F2NO5S and a molecular weight of 425.45 g/mol. Its IUPAC name is (E)-N-[2-(difluoromethylsulfonyl)phenyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(difluoromethylsulfonyl)phenyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55340127 |
| Molecular Formula | C20H21F2NO5S |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (E)-N-[2-(difluoromethylsulfonyl)phenyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)Nc2ccccc2S(=O)(=O)C(F)F)cc1OC |
| InChI | InChI=1S/C20H21F2NO5S/c1-3-12-28-16-10-8-14(13-17(16)27-2)9-11-19(24)23-15-6-4-5-7-18(15)29(25,26)20(21)22/h4-11,13,20H,3,12H2,1-2H3,(H,23,24)/b11-9+ |
| InChIKey | RMXIRPVFMOCGTA-PKNBQFBNSA-N |
| XLogP | 4.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|