C22H25BrN2O3S — CID 134036653
1-(4-bromophenyl)sulfonyl-N-(1-phenylcyclobutyl)piperidine-3-carboxamide (PubChem CID 134036653) has the molecular formula C22H25BrN2O3S and a molecular weight of 477.42 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-(1-phenylcyclobutyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-(1-phenylcyclobutyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 134036653 |
| Molecular Formula | C22H25BrN2O3S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-(1-phenylcyclobutyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1(c2ccccc2)CCC1)C1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C22H25BrN2O3S/c23-19-9-11-20(12-10-19)29(27,28)25-15-4-6-17(16-25)21(26)24-22(13-5-14-22)18-7-2-1-3-8-18/h1-3,7-12,17H,4-6,13-16H2,(H,24,26) |
| InChIKey | XUIUCUOMPJUYJH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |