C18H16Br2N2O3 — CID 134049859
5,6-dibromo-N-[2-(4-methoxyphenoxy)ethyl]-1H-indole-3-carboxamide (PubChem CID 134049859) has the molecular formula C18H16Br2N2O3 and a molecular weight of 468.15 g/mol. Its IUPAC name is 5,6-dibromo-N-[2-(4-methoxyphenoxy)ethyl]-1H-indole-3-carboxamide.
| Compound Name | 5,6-dibromo-N-[2-(4-methoxyphenoxy)ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 134049859 |
| Molecular Formula | C18H16Br2N2O3 |
| Molecular Weight | 468.15 g/mol |
| Exact Mass | 465.95 |
| IUPAC Name | 5,6-dibromo-N-[2-(4-methoxyphenoxy)ethyl]-1H-indole-3-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2c[nH]c3cc(Br)c(Br)cc23)cc1 |
| InChI | InChI=1S/C18H16Br2N2O3/c1-24-11-2-4-12(5-3-11)25-7-6-21-18(23)14-10-22-17-9-16(20)15(19)8-13(14)17/h2-5,8-10,22H,6-7H2,1H3,(H,21,23) |
| InChIKey | IHOKEWSGKIKWRA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|