About (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one
(4E)-4-hydroxyimino-2,5-dimethylhexan-3-one (PubChem CID 13405421) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one.
Molecular Properties
| Compound Name | (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one |
| PubChem CID | 13405421 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one |
| SMILES | CC(C)C(=O)/C(=N/O)C(C)C |
| InChI | InChI=1S/C8H15NO2/c1-5(2)7(9-11)8(10)6(3)4/h5-6,11H,1-4H3/b9-7+ |
| InChIKey | VGZOSZLFXNGJMJ-VQHVLOKHSA-N |
| XLogP | 1.70 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one?
The IUPAC name of (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one (CID 13405421) is (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one.
What is the SMILES notation for (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one?
The canonical SMILES for (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one is CC(C)C(=O)/C(=N/O)C(C)C.
What is the InChIKey of (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one?
The InChIKey is VGZOSZLFXNGJMJ-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H15NO2/c1-5(2)7(9-11)8(10)6(3)4/h5-6,11H,1-4H3/b9-7+.
What are the key properties of (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one?
(4E)-4-hydroxyimino-2,5-dimethylhexan-3-one has a molecular weight of 157.21 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-hydroxyimino-2,5-dimethylhexan-3-one is sourced from PubChem (CID 13405421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).