C19H22FNO — CID 134055535
3-(2,4-dimethylphenyl)-N-ethyl-N-(4-fluorophenyl)propanamide (PubChem CID 134055535) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N-ethyl-N-(4-fluorophenyl)propanamide.
| Compound Name | 3-(2,4-dimethylphenyl)-N-ethyl-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 134055535 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N-ethyl-N-(4-fluorophenyl)propanamide |
| SMILES | CCN(C(=O)CCc1ccc(C)cc1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNO/c1-4-21(18-10-8-17(20)9-11-18)19(22)12-7-16-6-5-14(2)13-15(16)3/h5-6,8-11,13H,4,7,12H2,1-3H3 |
| InChIKey | BRPRFIGFKICNNG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |