C20H21FN4O2S — CID 134056036
N-[4-(4-fluorophenoxy)butyl]-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide (PubChem CID 134056036) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 134056036 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)c1ccccc1CSc1ncn[nH]1 |
| InChI | InChI=1S/C20H21FN4O2S/c21-16-7-9-17(10-8-16)27-12-4-3-11-22-19(26)18-6-2-1-5-15(18)13-28-20-23-14-24-25-20/h1-2,5-10,14H,3-4,11-13H2,(H,22,26)(H,23,24,25) |
| InChIKey | CYKCHTQDEAAPMQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|