C15H20N2O2 — CID 134057626
3-(2,2-dimethylpropanoylamino)-N-prop-2-enylbenzamide (PubChem CID 134057626) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylamino)-N-prop-2-enylbenzamide.
| Compound Name | 3-(2,2-dimethylpropanoylamino)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 134057626 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-(2,2-dimethylpropanoylamino)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-5-9-16-13(18)11-7-6-8-12(10-11)17-14(19)15(2,3)4/h5-8,10H,1,9H2,2-4H3,(H,16,18)(H,17,19) |
| InChIKey | ZVPZHFHKNKHJMT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|