C19H23FN6O3 — CID 134060260
N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 134060260) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 134060260 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | Cn1ccnc1C(NC(=O)C1NNC2CCC([N+](=O)[O-])CC21)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN6O3/c1-25-9-8-21-18(25)16(11-2-4-12(20)5-3-11)22-19(27)17-14-10-13(26(28)29)6-7-15(14)23-24-17/h2-5,8-9,13-17,23-24H,6-7,10H2,1H3,(H,22,27) |
| InChIKey | BLVBBPQNEBFOHP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|