About 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane
2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane (PubChem CID 134067311) has the molecular formula C8H8BrF3N2O2
and a molecular weight of 301.06 g/mol. Its IUPAC name is 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane.
Molecular Properties
| Compound Name | 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane |
| PubChem CID | 134067311 |
| Molecular Formula | C8H8BrF3N2O2 |
| Molecular Weight | 301.06 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane |
| SMILES | FCF.Nc1c(Br)cc(CF)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6BrFN2O2.CH2F2/c8-5-1-4(3-9)2-6(7(5)10)11(12)13;2-1-3/h1-2H,3,10H2;1H2 |
| InChIKey | RRJHQJUGDXDUOA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.06 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane?
The IUPAC name of 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane (CID 134067311) is 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane.
What is the SMILES notation for 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane?
The canonical SMILES for 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane is FCF.Nc1c(Br)cc(CF)cc1[N+](=O)[O-].
What is the InChIKey of 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane?
The InChIKey is RRJHQJUGDXDUOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrFN2O2.CH2F2/c8-5-1-4(3-9)2-6(7(5)10)11(12)13;2-1-3/h1-2H,3,10H2;1H2.
What are the key properties of 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane?
2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane has a molecular weight of 301.06 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(fluoromethyl)-6-nitroaniline;difluoromethane is sourced from PubChem (CID 134067311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).