C14H28O4Si — CID 134068018
(3R,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethyl-2H-pyran-3,4-diol (PubChem CID 134068018) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is (3R,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethyl-2H-pyran-3,4-diol.
| Compound Name | (3R,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethyl-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 134068018 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (3R,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethyl-2H-pyran-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC=C[C@@](C)(O)[C@]1(C)O |
| InChI | InChI=1S/C14H28O4Si/c1-12(2,3)19(6,7)18-10-11-14(5,16)13(4,15)8-9-17-11/h8-9,11,15-16H,10H2,1-7H3/t11?,13-,14-/m1/s1 |
| InChIKey | MIWDEZXFBSEXFT-HIDCPEKUSA-N |
| XLogP | 2.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|