C18H29N5O2 — CID 134068370
N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-5-(2-methylpropyl)pyrazolidine-3-carboxamide (PubChem CID 134068370) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-5-(2-methylpropyl)pyrazolidine-3-carboxamide.
| Compound Name | N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-5-(2-methylpropyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134068370 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-5-(2-methylpropyl)pyrazolidine-3-carboxamide |
| SMILES | CC(C)CC1CC(C(=O)NCc2cccc(NC(=O)N(C)C)c2)NN1 |
| InChI | InChI=1S/C18H29N5O2/c1-12(2)8-15-10-16(22-21-15)17(24)19-11-13-6-5-7-14(9-13)20-18(25)23(3)4/h5-7,9,12,15-16,21-22H,8,10-11H2,1-4H3,(H,19,24)(H,20,25) |
| InChIKey | TUETWFSWKFGXID-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |