C17H20N4O3 — CID 134069498
N-[1-(2-amino-3,4-dioxocyclobuten-1-yl)piperidin-4-yl]-N-pyridin-2-ylpropanamide (PubChem CID 134069498) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[1-(2-amino-3,4-dioxocyclobuten-1-yl)piperidin-4-yl]-N-pyridin-2-ylpropanamide.
| Compound Name | N-[1-(2-amino-3,4-dioxocyclobuten-1-yl)piperidin-4-yl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 134069498 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-[1-(2-amino-3,4-dioxocyclobuten-1-yl)piperidin-4-yl]-N-pyridin-2-ylpropanamide |
| SMILES | CCC(=O)N(c1ccccn1)C1CCN(c2c(N)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C17H20N4O3/c1-2-13(22)21(12-5-3-4-8-19-12)11-6-9-20(10-7-11)15-14(18)16(23)17(15)24/h3-5,8,11H,2,6-7,9-10,18H2,1H3 |
| InChIKey | CUMGYNRCEGJFEM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|