C11H19ClN2O2 — CID 134069684
(2R,3aR,6aR)-N-(cyclopropylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride (PubChem CID 134069684) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is (2R,3aR,6aR)-N-(cyclopropylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | (2R,3aR,6aR)-N-(cyclopropylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 134069684 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (2R,3aR,6aR)-N-(cyclopropylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CC1)[C@H]1C[C@H]2NCC[C@H]2O1 |
| InChI | InChI=1S/C11H18N2O2.ClH/c14-11(13-6-7-1-2-7)10-5-8-9(15-10)3-4-12-8;/h7-10,12H,1-6H2,(H,13,14);1H/t8-,9-,10-;/m1./s1 |
| InChIKey | QYZPKAHKMYAXFX-RWDYHCJXSA-N |
| XLogP | 0.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |