C11H16ClN3O2S — CID 134069942
(2S,3aR,6aR)-N-(4-methyl-1,3-thiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride (PubChem CID 134069942) has the molecular formula C11H16ClN3O2S and a molecular weight of 289.79 g/mol. Its IUPAC name is (2S,3aR,6aR)-N-(4-methyl-1,3-thiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | (2S,3aR,6aR)-N-(4-methyl-1,3-thiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 134069942 |
| Molecular Formula | C11H16ClN3O2S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (2S,3aR,6aR)-N-(4-methyl-1,3-thiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cc1csc(NC(=O)[C@@H]2C[C@H]3NCC[C@H]3O2)n1.Cl |
| InChI | InChI=1S/C11H15N3O2S.ClH/c1-6-5-17-11(13-6)14-10(15)9-4-7-8(16-9)2-3-12-7;/h5,7-9,12H,2-4H2,1H3,(H,13,14,15);1H/t7-,8-,9+;/m1./s1 |
| InChIKey | FHGXMBJMGGXCHV-ZXKHYXLDSA-N |
| XLogP | 1.33 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |