C17H28N6O — CID 134075143
[3-[[methyl(propan-2-yl)amino]methyl]-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 134075143) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is [3-[[methyl(propan-2-yl)amino]methyl]-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [3-[[methyl(propan-2-yl)amino]methyl]-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 134075143 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | [3-[[methyl(propan-2-yl)amino]methyl]-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2CCC3C(C2)NNC3CN(C)C(C)C)cn1 |
| InChI | InChI=1S/C17H28N6O/c1-11(2)22(4)9-15-13-5-6-23(10-16(13)21-20-15)17(24)14-8-18-12(3)7-19-14/h7-8,11,13,15-16,20-21H,5-6,9-10H2,1-4H3 |
| InChIKey | YPLDZQAGRXHIBU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |