C16H28N6 — CID 134071728
N-methyl-N-[[6-(6-methylpyridazin-3-yl)-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-3-yl]methyl]propan-2-amine (PubChem CID 134071728) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is N-methyl-N-[[6-(6-methylpyridazin-3-yl)-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-3-yl]methyl]propan-2-amine.
| Compound Name | N-methyl-N-[[6-(6-methylpyridazin-3-yl)-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 134071728 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | N-methyl-N-[[6-(6-methylpyridazin-3-yl)-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-3-yl]methyl]propan-2-amine |
| SMILES | Cc1ccc(N2CCC3C(C2)NNC3CN(C)C(C)C)nn1 |
| InChI | InChI=1S/C16H28N6/c1-11(2)21(4)9-14-13-7-8-22(10-15(13)19-18-14)16-6-5-12(3)17-20-16/h5-6,11,13-15,18-19H,7-10H2,1-4H3 |
| InChIKey | JTIKLIOQPBUYMT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |