C18H28N4 — CID 97409934
N-[[(3aR,4R,7aS)-2-(6-methylpyridazin-3-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine (PubChem CID 97409934) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[[(3aR,4R,7aS)-2-(6-methylpyridazin-3-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine.
| Compound Name | N-[[(3aR,4R,7aS)-2-(6-methylpyridazin-3-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine |
|---|---|
| PubChem CID | 97409934 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N-[[(3aR,4R,7aS)-2-(6-methylpyridazin-3-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine |
| SMILES | Cc1ccc(N2C[C@H]3CCC[C@@H](CN(C)C4CC4)[C@H]3C2)nn1 |
| InChI | InChI=1S/C18H28N4/c1-13-6-9-18(20-19-13)22-11-15-5-3-4-14(17(15)12-22)10-21(2)16-7-8-16/h6,9,14-17H,3-5,7-8,10-12H2,1-2H3/t14-,15+,17+/m0/s1 |
| InChIKey | GXTVNJIYZYSKEZ-ZMSDIMECSA-N |
| XLogP | 2.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |