C14H17N7O2 — CID 134076092
6-[(pyrazine-2-carbonylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide (PubChem CID 134076092) has the molecular formula C14H17N7O2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 6-[(pyrazine-2-carbonylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide.
| Compound Name | 6-[(pyrazine-2-carbonylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide |
|---|---|
| PubChem CID | 134076092 |
| Molecular Formula | C14H17N7O2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 6-[(pyrazine-2-carbonylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide |
| SMILES | NC(=O)N1Cc2nccn2CC(CNC(=O)c2cnccn2)C1 |
| InChI | InChI=1S/C14H17N7O2/c15-14(23)21-8-10(7-20-4-3-18-12(20)9-21)5-19-13(22)11-6-16-1-2-17-11/h1-4,6,10H,5,7-9H2,(H2,15,23)(H,19,22) |
| InChIKey | UAHPGTVWMUCLIK-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |