C19H24N2O3 — CID 134076938
1-acetyl-N-cyclopentylspiro[2H-indole-3,4'-oxolane]-2'-carboxamide (PubChem CID 134076938) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-acetyl-N-cyclopentylspiro[2H-indole-3,4'-oxolane]-2'-carboxamide.
| Compound Name | 1-acetyl-N-cyclopentylspiro[2H-indole-3,4'-oxolane]-2'-carboxamide |
|---|---|
| PubChem CID | 134076938 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-acetyl-N-cyclopentylspiro[2H-indole-3,4'-oxolane]-2'-carboxamide |
| SMILES | CC(=O)N1CC2(COC(C(=O)NC3CCCC3)C2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O3/c1-13(22)21-11-19(15-8-4-5-9-16(15)21)10-17(24-12-19)18(23)20-14-6-2-3-7-14/h4-5,8-9,14,17H,2-3,6-7,10-12H2,1H3,(H,20,23) |
| InChIKey | CJBRIVIFZFQIFM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |