About 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one
1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one (PubChem CID 134690534) has the molecular formula C25H28N2O4
and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one |
| PubChem CID | 134690534 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one |
| SMILES | O=C(CCN1CCOCC1)C1CC2(CO1)CN(C(=O)c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C25H28N2O4/c28-22(10-11-26-12-14-30-15-13-26)23-16-25(18-31-23)17-27(21-9-5-4-8-20(21)25)24(29)19-6-2-1-3-7-19/h1-9,23H,10-18H2 |
| InChIKey | KXAVVQHWHNZVRT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one?
The IUPAC name of 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one (CID 134690534) is 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one.
What is the SMILES notation for 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one?
The canonical SMILES for 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one is O=C(CCN1CCOCC1)C1CC2(CO1)CN(C(=O)c1ccccc1)c1ccccc12.
What is the InChIKey of 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one?
The InChIKey is KXAVVQHWHNZVRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O4/c28-22(10-11-26-12-14-30-15-13-26)23-16-25(18-31-23)17-27(21-9-5-4-8-20(21)25)24(29)19-6-2-1-3-7-19/h1-9,23H,10-18H2.
What are the key properties of 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one?
1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one has a molecular weight of 420.51 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzoylspiro[2H-indole-3,4'-oxolane]-2'-yl)-3-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 134690534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).