C16H18N4O3S — CID 134078163
1-(3-methyl-1,2-oxazole-4-carbonyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 134078163) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(3-methyl-1,2-oxazole-4-carbonyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | 1-(3-methyl-1,2-oxazole-4-carbonyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 134078163 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-(3-methyl-1,2-oxazole-4-carbonyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | Cc1nc(CN2C(=O)CC3C2CCN3C(=O)c2conc2C)cs1 |
| InChI | InChI=1S/C16H18N4O3S/c1-9-12(7-23-18-9)16(22)19-4-3-13-14(19)5-15(21)20(13)6-11-8-24-10(2)17-11/h7-8,13-14H,3-6H2,1-2H3 |
| InChIKey | XTLWPIHNKFHGAX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |