C12H20N4O4S — CID 134078502
N-(2-methoxyethyl)-3-methyl-5-methylsulfonyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 134078502) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-methyl-5-methylsulfonyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-methyl-5-methylsulfonyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134078502 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(2-methoxyethyl)-3-methyl-5-methylsulfonyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | COCCNC(=O)C1c2c(ncn2C)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C12H20N4O4S/c1-15-8-14-9-4-6-16(21(3,18)19)11(10(9)15)12(17)13-5-7-20-2/h8,11H,4-7H2,1-3H3,(H,13,17) |
| InChIKey | COKPEQLJYNOSDR-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|