C11H14Cl3NO — CID 13407923
N-[2-(2,4,5-trichlorophenoxy)ethyl]propan-1-amine (PubChem CID 13407923) has the molecular formula C11H14Cl3NO and a molecular weight of 282.60 g/mol. Its IUPAC name is N-[2-(2,4,5-trichlorophenoxy)ethyl]propan-1-amine.
| Compound Name | N-[2-(2,4,5-trichlorophenoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 13407923 |
| Molecular Formula | C11H14Cl3NO |
| Molecular Weight | 282.60 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | N-[2-(2,4,5-trichlorophenoxy)ethyl]propan-1-amine |
| SMILES | CCCNCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3NO/c1-2-3-15-4-5-16-11-7-9(13)8(12)6-10(11)14/h6-7,15H,2-5H2,1H3 |
| InChIKey | DRRDHKHGSCHFMP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|