C16H21N5O2S — CID 134080022
N-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-5-(2-hydroxyphenyl)pyrazolidine-3-carboxamide (PubChem CID 134080022) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-5-(2-hydroxyphenyl)pyrazolidine-3-carboxamide.
| Compound Name | N-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-5-(2-hydroxyphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134080022 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-5-(2-hydroxyphenyl)pyrazolidine-3-carboxamide |
| SMILES | CN(C)c1nc(CNC(=O)C2CC(c3ccccc3O)NN2)cs1 |
| InChI | InChI=1S/C16H21N5O2S/c1-21(2)16-18-10(9-24-16)8-17-15(23)13-7-12(19-20-13)11-5-3-4-6-14(11)22/h3-6,9,12-13,19-20,22H,7-8H2,1-2H3,(H,17,23) |
| InChIKey | QOGBWZOPINCLCE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|