C14H18N6O2S — CID 134080669
5-(2-hydroxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazolidine-3-carboxamide (PubChem CID 134080669) has the molecular formula C14H18N6O2S and a molecular weight of 334.41 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazolidine-3-carboxamide.
| Compound Name | 5-(2-hydroxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134080669 |
| Molecular Formula | C14H18N6O2S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-(2-hydroxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazolidine-3-carboxamide |
| SMILES | O=C(NCCSc1ncn[nH]1)C1CC(c2ccccc2O)NN1 |
| InChI | InChI=1S/C14H18N6O2S/c21-12-4-2-1-3-9(12)10-7-11(19-18-10)13(22)15-5-6-23-14-16-8-17-20-14/h1-4,8,10-11,18-19,21H,5-7H2,(H,15,22)(H,16,17,20) |
| InChIKey | JIRQXBLCAPLJIU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|